C16H30N2O3 — CID 144505444
tert-butyl formate;ethane;1-ethyl-4,5,6,7-tetrahydro-2H-indazol-3-one (PubChem CID 144505444) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is tert-butyl formate;ethane;1-ethyl-4,5,6,7-tetrahydro-2H-indazol-3-one.
| Compound Name | tert-butyl formate;ethane;1-ethyl-4,5,6,7-tetrahydro-2H-indazol-3-one |
|---|---|
| PubChem CID | 144505444 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | tert-butyl formate;ethane;1-ethyl-4,5,6,7-tetrahydro-2H-indazol-3-one |
| SMILES | CC.CC(C)(C)OC=O.CCn1[nH]c(=O)c2c1CCCC2 |
| InChI | InChI=1S/C9H14N2O.C5H10O2.C2H6/c1-2-11-8-6-4-3-5-7(8)9(12)10-11;1-5(2,3)7-4-6;1-2/h2-6H2,1H3,(H,10,12);4H,1-3H3;1-2H3 |
| InChIKey | GRDABUYPLNMWNR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|