About 2-(2,2,2-trifluoroethanimidoyl)cyclohexen-1-amine
2-(2,2,2-trifluoroethanimidoyl)cyclohexen-1-amine (PubChem CID 144505445) has the molecular formula C8H11F3N2
and a molecular weight of 192.18 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethanimidoyl)cyclohexen-1-amine.
Molecular Properties
| Compound Name | 2-(2,2,2-trifluoroethanimidoyl)cyclohexen-1-amine |
| PubChem CID | 144505445 |
| Molecular Formula | C8H11F3N2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-(2,2,2-trifluoroethanimidoyl)cyclohexen-1-amine |
| SMILES | [H]/N=C(/C1=C(N)CCCC1)C(F)(F)F |
| InChI | InChI=1S/C8H11F3N2/c9-8(10,11)7(13)5-3-1-2-4-6(5)12/h13H,1-4,12H2/b13-7- |
| InChIKey | VTITVXNCMHWNKY-QPEQYQDCSA-N |
| XLogP | 2.36 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2,2-trifluoroethanimidoyl)cyclohexen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2,2-trifluoroethanimidoyl)cyclohexen-1-amine?
The IUPAC name of 2-(2,2,2-trifluoroethanimidoyl)cyclohexen-1-amine (CID 144505445) is 2-(2,2,2-trifluoroethanimidoyl)cyclohexen-1-amine.
What is the SMILES notation for 2-(2,2,2-trifluoroethanimidoyl)cyclohexen-1-amine?
The canonical SMILES for 2-(2,2,2-trifluoroethanimidoyl)cyclohexen-1-amine is [H]/N=C(/C1=C(N)CCCC1)C(F)(F)F.
What is the InChIKey of 2-(2,2,2-trifluoroethanimidoyl)cyclohexen-1-amine?
The InChIKey is VTITVXNCMHWNKY-QPEQYQDCSA-N. The full InChI is InChI=1S/C8H11F3N2/c9-8(10,11)7(13)5-3-1-2-4-6(5)12/h13H,1-4,12H2/b13-7-.
What are the key properties of 2-(2,2,2-trifluoroethanimidoyl)cyclohexen-1-amine?
2-(2,2,2-trifluoroethanimidoyl)cyclohexen-1-amine has a molecular weight of 192.18 g/mol, XLogP of 2.36, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2,2-trifluoroethanimidoyl)cyclohexen-1-amine is sourced from PubChem (CID 144505445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).