C10H10F6N2O2 — CID 144506077
2-[3-(difluoromethyl)-4,4,7,7-tetrafluoro-5,6-dihydroindazol-1-yl]ethane-1,1-diol (PubChem CID 144506077) has the molecular formula C10H10F6N2O2 and a molecular weight of 304.19 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-4,4,7,7-tetrafluoro-5,6-dihydroindazol-1-yl]ethane-1,1-diol.
| Compound Name | 2-[3-(difluoromethyl)-4,4,7,7-tetrafluoro-5,6-dihydroindazol-1-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 144506077 |
| Molecular Formula | C10H10F6N2O2 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[3-(difluoromethyl)-4,4,7,7-tetrafluoro-5,6-dihydroindazol-1-yl]ethane-1,1-diol |
| SMILES | OC(O)Cn1nc(C(F)F)c2c1C(F)(F)CCC2(F)F |
| InChI | InChI=1S/C10H10F6N2O2/c11-8(12)6-5-7(18(17-6)3-4(19)20)10(15,16)2-1-9(5,13)14/h4,8,19-20H,1-3H2 |
| InChIKey | UTUXYQHIQJPONZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|