About 2-(3-ethyl-4,5-dimethylpyrazol-1-yl)ethanol
2-(3-ethyl-4,5-dimethylpyrazol-1-yl)ethanol (PubChem CID 144506265) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-(3-ethyl-4,5-dimethylpyrazol-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(3-ethyl-4,5-dimethylpyrazol-1-yl)ethanol |
| PubChem CID | 144506265 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 2-(3-ethyl-4,5-dimethylpyrazol-1-yl)ethanol |
| SMILES | CCc1nn(CCO)c(C)c1C |
| InChI | InChI=1S/C9H16N2O/c1-4-9-7(2)8(3)11(10-9)5-6-12/h12H,4-6H2,1-3H3 |
| InChIKey | KPWOGKUYTRKYGL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-ethyl-4,5-dimethylpyrazol-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-4,5-dimethylpyrazol-1-yl)ethanol?
The IUPAC name of 2-(3-ethyl-4,5-dimethylpyrazol-1-yl)ethanol (CID 144506265) is 2-(3-ethyl-4,5-dimethylpyrazol-1-yl)ethanol.
What is the SMILES notation for 2-(3-ethyl-4,5-dimethylpyrazol-1-yl)ethanol?
The canonical SMILES for 2-(3-ethyl-4,5-dimethylpyrazol-1-yl)ethanol is CCc1nn(CCO)c(C)c1C.
What is the InChIKey of 2-(3-ethyl-4,5-dimethylpyrazol-1-yl)ethanol?
The InChIKey is KPWOGKUYTRKYGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-4-9-7(2)8(3)11(10-9)5-6-12/h12H,4-6H2,1-3H3.
What are the key properties of 2-(3-ethyl-4,5-dimethylpyrazol-1-yl)ethanol?
2-(3-ethyl-4,5-dimethylpyrazol-1-yl)ethanol has a molecular weight of 168.24 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-4,5-dimethylpyrazol-1-yl)ethanol is sourced from PubChem (CID 144506265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).