About ethane;7-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-ol
ethane;7-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-ol (PubChem CID 144506413) has the molecular formula C16H24O
and a molecular weight of 232.37 g/mol. Its IUPAC name is ethane;7-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-ol.
Molecular Properties
| Compound Name | ethane;7-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-ol |
| PubChem CID | 144506413 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | ethane;7-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-ol |
| SMILES | CC.Cc1ccc(O)c2c1CC1(CCCC1)C2 |
| InChI | InChI=1S/C14H18O.C2H6/c1-10-4-5-13(15)12-9-14(8-11(10)12)6-2-3-7-14;1-2/h4-5,15H,2-3,6-9H2,1H3;1-2H3 |
| InChIKey | UKQNDBVQXGHEKY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;7-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-ol?
The IUPAC name of ethane;7-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-ol (CID 144506413) is ethane;7-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-ol.
What is the SMILES notation for ethane;7-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-ol?
The canonical SMILES for ethane;7-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-ol is CC.Cc1ccc(O)c2c1CC1(CCCC1)C2.
What is the InChIKey of ethane;7-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-ol?
The InChIKey is UKQNDBVQXGHEKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O.C2H6/c1-10-4-5-13(15)12-9-14(8-11(10)12)6-2-3-7-14;1-2/h4-5,15H,2-3,6-9H2,1H3;1-2H3.
What are the key properties of ethane;7-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-ol?
ethane;7-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-ol has a molecular weight of 232.37 g/mol, XLogP of 4.39, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methylspiro[1,3-dihydroindene-2,1'-cyclopentane]-4-ol is sourced from PubChem (CID 144506413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).