C33H37N7 — CID 144506773
4-methyl-1-N-[1-[5-(4-methylpiperazin-1-yl)-5,6,7,8-tetrahydronaphthalen-2-yl]ethenyl]-3-N-(4-pyridin-3-ylpyrimidin-2-yl)benzene-1,3-diamine (PubChem CID 144506773) has the molecular formula C33H37N7 and a molecular weight of 531.71 g/mol. Its IUPAC name is 4-methyl-1-N-[1-[5-(4-methylpiperazin-1-yl)-5,6,7,8-tetrahydronaphthalen-2-yl]ethenyl]-3-N-(4-pyridin-3-ylpyrimidin-2-yl)benzene-1,3-diamine.
| Compound Name | 4-methyl-1-N-[1-[5-(4-methylpiperazin-1-yl)-5,6,7,8-tetrahydronaphthalen-2-yl]ethenyl]-3-N-(4-pyridin-3-ylpyrimidin-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 144506773 |
| Molecular Formula | C33H37N7 |
| Molecular Weight | 531.71 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | 4-methyl-1-N-[1-[5-(4-methylpiperazin-1-yl)-5,6,7,8-tetrahydronaphthalen-2-yl]ethenyl]-3-N-(4-pyridin-3-ylpyrimidin-2-yl)benzene-1,3-diamine |
| SMILES | C=C(Nc1ccc(C)c(Nc2nccc(-c3cccnc3)n2)c1)c1ccc2c(c1)CCCC2N1CCN(C)CC1 |
| InChI | InChI=1S/C33H37N7/c1-23-9-11-28(21-31(23)38-33-35-15-13-30(37-33)27-7-5-14-34-22-27)36-24(2)25-10-12-29-26(20-25)6-4-8-32(29)40-18-16-39(3)17-19-40/h5,7,9-15,20-22,32,36H,2,4,6,8,16-19H2,1,3H3,(H,35,37,38) |
| InChIKey | ZBJADEVEPGRMIN-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.71 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |