C16H27NO — CID 144506886
4-[(2Z,4Z)-4-methyl-3-[(Z)-prop-1-enyl]hepta-2,4-dienoxy]piperidine (PubChem CID 144506886) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 4-[(2Z,4Z)-4-methyl-3-[(Z)-prop-1-enyl]hepta-2,4-dienoxy]piperidine.
| Compound Name | 4-[(2Z,4Z)-4-methyl-3-[(Z)-prop-1-enyl]hepta-2,4-dienoxy]piperidine |
|---|---|
| PubChem CID | 144506886 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 4-[(2Z,4Z)-4-methyl-3-[(Z)-prop-1-enyl]hepta-2,4-dienoxy]piperidine |
| SMILES | C/C=C\C(=C\COC1CCNCC1)\C(C)=C/CC |
| InChI | InChI=1S/C16H27NO/c1-4-6-14(3)15(7-5-2)10-13-18-16-8-11-17-12-9-16/h5-7,10,16-17H,4,8-9,11-13H2,1-3H3/b7-5-,14-6-,15-10- |
| InChIKey | VFRMVHSWTZHDDH-PWJSYZGOSA-N |
| XLogP | 3.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|