About 3,3-difluoro-4-methyl-1-(oxan-4-yl)piperidine;ethane
3,3-difluoro-4-methyl-1-(oxan-4-yl)piperidine;ethane (PubChem CID 144507261) has the molecular formula C13H25F2NO
and a molecular weight of 249.34 g/mol. Its IUPAC name is 3,3-difluoro-4-methyl-1-(oxan-4-yl)piperidine;ethane.
Molecular Properties
| Compound Name | 3,3-difluoro-4-methyl-1-(oxan-4-yl)piperidine;ethane |
| PubChem CID | 144507261 |
| Molecular Formula | C13H25F2NO |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 3,3-difluoro-4-methyl-1-(oxan-4-yl)piperidine;ethane |
| SMILES | CC.CC1CCN(C2CCOCC2)CC1(F)F |
| InChI | InChI=1S/C11H19F2NO.C2H6/c1-9-2-5-14(8-11(9,12)13)10-3-6-15-7-4-10;1-2/h9-10H,2-8H2,1H3;1-2H3 |
| InChIKey | GISUGHYSWPTWNT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-difluoro-4-methyl-1-(oxan-4-yl)piperidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-4-methyl-1-(oxan-4-yl)piperidine;ethane?
The IUPAC name of 3,3-difluoro-4-methyl-1-(oxan-4-yl)piperidine;ethane (CID 144507261) is 3,3-difluoro-4-methyl-1-(oxan-4-yl)piperidine;ethane.
What is the SMILES notation for 3,3-difluoro-4-methyl-1-(oxan-4-yl)piperidine;ethane?
The canonical SMILES for 3,3-difluoro-4-methyl-1-(oxan-4-yl)piperidine;ethane is CC.CC1CCN(C2CCOCC2)CC1(F)F.
What is the InChIKey of 3,3-difluoro-4-methyl-1-(oxan-4-yl)piperidine;ethane?
The InChIKey is GISUGHYSWPTWNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2NO.C2H6/c1-9-2-5-14(8-11(9,12)13)10-3-6-15-7-4-10;1-2/h9-10H,2-8H2,1H3;1-2H3.
What are the key properties of 3,3-difluoro-4-methyl-1-(oxan-4-yl)piperidine;ethane?
3,3-difluoro-4-methyl-1-(oxan-4-yl)piperidine;ethane has a molecular weight of 249.34 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-4-methyl-1-(oxan-4-yl)piperidine;ethane is sourced from PubChem (CID 144507261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).