About ethane;3,3,3-trifluoro-N-(3-methylcyclopentyl)propanamide
ethane;3,3,3-trifluoro-N-(3-methylcyclopentyl)propanamide (PubChem CID 144507421) has the molecular formula C11H20F3NO
and a molecular weight of 239.28 g/mol. Its IUPAC name is ethane;3,3,3-trifluoro-N-(3-methylcyclopentyl)propanamide.
Molecular Properties
| Compound Name | ethane;3,3,3-trifluoro-N-(3-methylcyclopentyl)propanamide |
| PubChem CID | 144507421 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | ethane;3,3,3-trifluoro-N-(3-methylcyclopentyl)propanamide |
| SMILES | CC.CC1CCC(NC(=O)CC(F)(F)F)C1 |
| InChI | InChI=1S/C9H14F3NO.C2H6/c1-6-2-3-7(4-6)13-8(14)5-9(10,11)12;1-2/h6-7H,2-5H2,1H3,(H,13,14);1-2H3 |
| InChIKey | QVNQSVDWZFKDLL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;3,3,3-trifluoro-N-(3-methylcyclopentyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3,3,3-trifluoro-N-(3-methylcyclopentyl)propanamide?
The IUPAC name of ethane;3,3,3-trifluoro-N-(3-methylcyclopentyl)propanamide (CID 144507421) is ethane;3,3,3-trifluoro-N-(3-methylcyclopentyl)propanamide.
What is the SMILES notation for ethane;3,3,3-trifluoro-N-(3-methylcyclopentyl)propanamide?
The canonical SMILES for ethane;3,3,3-trifluoro-N-(3-methylcyclopentyl)propanamide is CC.CC1CCC(NC(=O)CC(F)(F)F)C1.
What is the InChIKey of ethane;3,3,3-trifluoro-N-(3-methylcyclopentyl)propanamide?
The InChIKey is QVNQSVDWZFKDLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO.C2H6/c1-6-2-3-7(4-6)13-8(14)5-9(10,11)12;1-2/h6-7H,2-5H2,1H3,(H,13,14);1-2H3.
What are the key properties of ethane;3,3,3-trifluoro-N-(3-methylcyclopentyl)propanamide?
ethane;3,3,3-trifluoro-N-(3-methylcyclopentyl)propanamide has a molecular weight of 239.28 g/mol, XLogP of 3.27, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3,3,3-trifluoro-N-(3-methylcyclopentyl)propanamide is sourced from PubChem (CID 144507421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).