About 2,2-dimethyl-3-oxo-3-pyrrolidin-1-ylpropanenitrile;ethene
2,2-dimethyl-3-oxo-3-pyrrolidin-1-ylpropanenitrile;ethene (PubChem CID 144507445) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 2,2-dimethyl-3-oxo-3-pyrrolidin-1-ylpropanenitrile;ethene.
Molecular Properties
| Compound Name | 2,2-dimethyl-3-oxo-3-pyrrolidin-1-ylpropanenitrile;ethene |
| PubChem CID | 144507445 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2,2-dimethyl-3-oxo-3-pyrrolidin-1-ylpropanenitrile;ethene |
| SMILES | C=C.CC(C)(C#N)C(=O)N1CCCC1 |
| InChI | InChI=1S/C9H14N2O.C2H4/c1-9(2,7-10)8(12)11-5-3-4-6-11;1-2/h3-6H2,1-2H3;1-2H2 |
| InChIKey | VPLNYUWGTNNJMV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-3-oxo-3-pyrrolidin-1-ylpropanenitrile;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3-oxo-3-pyrrolidin-1-ylpropanenitrile;ethene?
The IUPAC name of 2,2-dimethyl-3-oxo-3-pyrrolidin-1-ylpropanenitrile;ethene (CID 144507445) is 2,2-dimethyl-3-oxo-3-pyrrolidin-1-ylpropanenitrile;ethene.
What is the SMILES notation for 2,2-dimethyl-3-oxo-3-pyrrolidin-1-ylpropanenitrile;ethene?
The canonical SMILES for 2,2-dimethyl-3-oxo-3-pyrrolidin-1-ylpropanenitrile;ethene is C=C.CC(C)(C#N)C(=O)N1CCCC1.
What is the InChIKey of 2,2-dimethyl-3-oxo-3-pyrrolidin-1-ylpropanenitrile;ethene?
The InChIKey is VPLNYUWGTNNJMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O.C2H4/c1-9(2,7-10)8(12)11-5-3-4-6-11;1-2/h3-6H2,1-2H3;1-2H2.
What are the key properties of 2,2-dimethyl-3-oxo-3-pyrrolidin-1-ylpropanenitrile;ethene?
2,2-dimethyl-3-oxo-3-pyrrolidin-1-ylpropanenitrile;ethene has a molecular weight of 194.28 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-oxo-3-pyrrolidin-1-ylpropanenitrile;ethene is sourced from PubChem (CID 144507445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).