C18H22N4O — CID 144507488
acetylene;cyclohexanol;2-methyl-3H-imidazo[4,5-c][1,5]naphthyridine (PubChem CID 144507488) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is acetylene;cyclohexanol;2-methyl-3H-imidazo[4,5-c][1,5]naphthyridine.
| Compound Name | acetylene;cyclohexanol;2-methyl-3H-imidazo[4,5-c][1,5]naphthyridine |
|---|---|
| PubChem CID | 144507488 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | acetylene;cyclohexanol;2-methyl-3H-imidazo[4,5-c][1,5]naphthyridine |
| SMILES | C#C.Cc1nc2c(cnc3cccnc32)[nH]1.OC1CCCCC1 |
| InChI | InChI=1S/C10H8N4.C6H12O.C2H2/c1-6-13-8-5-12-7-3-2-4-11-9(7)10(8)14-6;7-6-4-2-1-3-5-6;1-2/h2-5H,1H3,(H,13,14);6-7H,1-5H2;1-2H |
| InChIKey | POFLMTJSDZUWOH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|