3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane

C7H16F2N2O — CID 144507525

IUPAC3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane
SMILESCCC.NC(=O)N1CC(F)(F)C1.[H][H]
InChIInChI=1S/C4H6F2N2O.C3H8.H2/c5-4(6)1-8(2-4)3(7)9;1-3-2;/h1-2H2,(H2,7,9);3H2,1-2H3;1H
InChIKeyQKPCDQKUPNCJCJ-UHFFFAOYSA-N
MW182.21 g/mol
LogP1.68
Rot. Bonds

About 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane

3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane (PubChem CID 144507525) has the molecular formula C7H16F2N2O and a molecular weight of 182.21 g/mol. Its IUPAC name is 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane.

Molecular Properties

Compound Name3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane
PubChem CID144507525
Molecular FormulaC7H16F2N2O
Molecular Weight182.21 g/mol
Exact Mass182.12
IUPAC Name3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane
SMILESCCC.NC(=O)N1CC(F)(F)C1.[H][H]
InChIInChI=1S/C4H6F2N2O.C3H8.H2/c5-4(6)1-8(2-4)3(7)9;1-3-2;/h1-2H2,(H2,7,9);3H2,1-2H3;1H
InChIKeyQKPCDQKUPNCJCJ-UHFFFAOYSA-N
XLogP1.68
TPSA46.33 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.21
LogP ≤ 51.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane?
The IUPAC name of 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane (CID 144507525) is 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane.
What is the SMILES notation for 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane?
The canonical SMILES for 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane is CCC.NC(=O)N1CC(F)(F)C1.[H][H].
What is the InChIKey of 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane?
The InChIKey is QKPCDQKUPNCJCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F2N2O.C3H8.H2/c5-4(6)1-8(2-4)3(7)9;1-3-2;/h1-2H2,(H2,7,9);3H2,1-2H3;1H.
What are the key properties of 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane?
3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane has a molecular weight of 182.21 g/mol, XLogP of 1.68, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane is sourced from PubChem (CID 144507525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).