About 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane
3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane (PubChem CID 144507525) has the molecular formula C7H16F2N2O
and a molecular weight of 182.21 g/mol. Its IUPAC name is 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane.
Analyze 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane?
The IUPAC name of 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane (CID 144507525) is 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane.
What is the SMILES notation for 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane?
The canonical SMILES for 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane is CCC.NC(=O)N1CC(F)(F)C1.[H][H].
What is the InChIKey of 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane?
The InChIKey is QKPCDQKUPNCJCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F2N2O.C3H8.H2/c5-4(6)1-8(2-4)3(7)9;1-3-2;/h1-2H2,(H2,7,9);3H2,1-2H3;1H.
What are the key properties of 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane?
3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane has a molecular weight of 182.21 g/mol, XLogP of 1.68, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoroazetidine-1-carboxamide;molecular hydrogen;propane is sourced from PubChem (CID 144507525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).