C10H19NO5 — CID 144507621
N-[(4R)-2-[(2S)-2,3-dihydroxypropyl]-4-hydroxyoxan-3-yl]acetamide (PubChem CID 144507621) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is N-[(4R)-2-[(2S)-2,3-dihydroxypropyl]-4-hydroxyoxan-3-yl]acetamide.
| Compound Name | N-[(4R)-2-[(2S)-2,3-dihydroxypropyl]-4-hydroxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 144507621 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | N-[(4R)-2-[(2S)-2,3-dihydroxypropyl]-4-hydroxyoxan-3-yl]acetamide |
| SMILES | CC(=O)NC1C(C[C@H](O)CO)OCC[C@H]1O |
| InChI | InChI=1S/C10H19NO5/c1-6(13)11-10-8(15)2-3-16-9(10)4-7(14)5-12/h7-10,12,14-15H,2-5H2,1H3,(H,11,13)/t7-,8+,9?,10?/m0/s1 |
| InChIKey | ZMPVGMWFKPDVSE-AFWXGSBKSA-N |
| XLogP | -1.62 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |