C45H33N5 — CID 144508186
14-[4-[4-[(2Z,4E)-hepta-2,4-dien-4-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-3,10-diazahexacyclo[15.8.0.02,10.04,9.011,16.018,23]pentacosa-1(17),2,4,6,8,11(16),12,14,18,20,22,24-dodecaene (PubChem CID 144508186) has the molecular formula C45H33N5 and a molecular weight of 643.79 g/mol. Its IUPAC name is 14-[4-[4-[(2Z,4E)-hepta-2,4-dien-4-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-3,10-diazahexacyclo[15.8.0.02,10.04,9.011,16.018,23]pentacosa-1(17),2,4,6,8,11(16),12,14,18,20,22,24-dodecaene.
| Compound Name | 14-[4-[4-[(2Z,4E)-hepta-2,4-dien-4-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-3,10-diazahexacyclo[15.8.0.02,10.04,9.011,16.018,23]pentacosa-1(17),2,4,6,8,11(16),12,14,18,20,22,24-dodecaene |
|---|---|
| PubChem CID | 144508186 |
| Molecular Formula | C45H33N5 |
| Molecular Weight | 643.79 g/mol |
| Exact Mass | 643.27 |
| IUPAC Name | 14-[4-[4-[(2Z,4E)-hepta-2,4-dien-4-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-3,10-diazahexacyclo[15.8.0.02,10.04,9.011,16.018,23]pentacosa-1(17),2,4,6,8,11(16),12,14,18,20,22,24-dodecaene |
| SMILES | C/C=C\C(=C/CC)c1nc(-c2ccccc2)nc(-c2ccc(-c3ccc4c(c3)c3c5ccccc5ccc3c3nc5ccccc5n43)cc2)n1 |
| InChI | InChI=1S/C45H33N5/c1-3-12-31(13-4-2)42-47-43(32-15-6-5-7-16-32)49-44(48-42)33-22-20-29(21-23-33)34-25-27-39-37(28-34)41-35-17-9-8-14-30(35)24-26-36(41)45-46-38-18-10-11-19-40(38)50(39)45/h3,5-28H,4H2,1-2H3/b12-3-,31-13+ |
| InChIKey | RUWJHXUQOOFAPF-REPGNSOQSA-N |
| XLogP | 11.50 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.79 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|