C28H26BN3O2 — CID 144508455
(5E)-4-methylidene-5-prop-2-enylidene-11-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,14,21-triazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,6,8(13),9,11,15,17,19-nonaene (PubChem CID 144508455) has the molecular formula C28H26BN3O2 and a molecular weight of 447.35 g/mol. Its IUPAC name is (5E)-4-methylidene-5-prop-2-enylidene-11-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,14,21-triazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,6,8(13),9,11,15,17,19-nonaene.
| Compound Name | (5E)-4-methylidene-5-prop-2-enylidene-11-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,14,21-triazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,6,8(13),9,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 144508455 |
| Molecular Formula | C28H26BN3O2 |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | (5E)-4-methylidene-5-prop-2-enylidene-11-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,14,21-triazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,6,8(13),9,11,15,17,19-nonaene |
| SMILES | C=C/C=c1/nc2c3ccc(B4OC(C)(C)C(C)(C)O4)cc3n3c4ccccc4nc3c2cc1=C |
| InChI | InChI=1S/C28H26BN3O2/c1-7-10-21-17(2)15-20-25(30-21)19-14-13-18(29-33-27(3,4)28(5,6)34-29)16-24(19)32-23-12-9-8-11-22(23)31-26(20)32/h7-16H,1-2H2,3-6H3/b21-10+ |
| InChIKey | WYRBTHHSXWZHIB-UFFVCSGVSA-N |
| XLogP | 3.86 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|