C12H12O3 — CID 144508857
spiro[10-oxatetracyclo[6.3.0.02,4.04,7]undecane-3,1'-cyclopropane]-9,11-dione (PubChem CID 144508857) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is spiro[10-oxatetracyclo[6.3.0.02,4.04,7]undecane-3,1'-cyclopropane]-9,11-dione.
| Compound Name | spiro[10-oxatetracyclo[6.3.0.02,4.04,7]undecane-3,1'-cyclopropane]-9,11-dione |
|---|---|
| PubChem CID | 144508857 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | spiro[10-oxatetracyclo[6.3.0.02,4.04,7]undecane-3,1'-cyclopropane]-9,11-dione |
| SMILES | O=C1OC(=O)C2C1C1CCC13C2C31CC1 |
| InChI | InChI=1S/C12H12O3/c13-9-6-5-1-2-12(5)8(11(12)3-4-11)7(6)10(14)15-9/h5-8H,1-4H2 |
| InChIKey | BKBSYBZICOLGIZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|