C35H28F3N5O2S — CID 144509131
(Z)-2-cyano-N-[4-[4-methyl-1-[4-(trifluoromethoxy)phenyl]-4,5-dihydrodiazepin-3-yl]phenyl]-3-(2-phenylanilino)-3-sulfanylprop-2-enamide (PubChem CID 144509131) has the molecular formula C35H28F3N5O2S and a molecular weight of 639.70 g/mol. Its IUPAC name is (Z)-2-cyano-N-[4-[4-methyl-1-[4-(trifluoromethoxy)phenyl]-4,5-dihydrodiazepin-3-yl]phenyl]-3-(2-phenylanilino)-3-sulfanylprop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[4-[4-methyl-1-[4-(trifluoromethoxy)phenyl]-4,5-dihydrodiazepin-3-yl]phenyl]-3-(2-phenylanilino)-3-sulfanylprop-2-enamide |
|---|---|
| PubChem CID | 144509131 |
| Molecular Formula | C35H28F3N5O2S |
| Molecular Weight | 639.70 g/mol |
| Exact Mass | 639.19 |
| IUPAC Name | (Z)-2-cyano-N-[4-[4-methyl-1-[4-(trifluoromethoxy)phenyl]-4,5-dihydrodiazepin-3-yl]phenyl]-3-(2-phenylanilino)-3-sulfanylprop-2-enamide |
| SMILES | CC1CC=CN(c2ccc(OC(F)(F)F)cc2)N=C1c1ccc(NC(=O)/C(C#N)=C(\S)Nc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C35H28F3N5O2S/c1-23-8-7-21-43(27-17-19-28(20-18-27)45-35(36,37)38)42-32(23)25-13-15-26(16-14-25)40-33(44)30(22-39)34(46)41-31-12-6-5-11-29(31)24-9-3-2-4-10-24/h2-7,9-21,23,41,46H,8H2,1H3,(H,40,44)/b34-30- |
| InChIKey | HKZLTVFKHPBRES-BVNFUTIRSA-N |
| XLogP | 8.73 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.70 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|