C19H38S — CID 144509144
ethane;(Z,5E)-5-ethylidene-7,7,9,9-tetramethyl-6-methylsulfanyldec-3-ene (PubChem CID 144509144) has the molecular formula C19H38S and a molecular weight of 298.58 g/mol. Its IUPAC name is ethane;(Z,5E)-5-ethylidene-7,7,9,9-tetramethyl-6-methylsulfanyldec-3-ene.
| Compound Name | ethane;(Z,5E)-5-ethylidene-7,7,9,9-tetramethyl-6-methylsulfanyldec-3-ene |
|---|---|
| PubChem CID | 144509144 |
| Molecular Formula | C19H38S |
| Molecular Weight | 298.58 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | ethane;(Z,5E)-5-ethylidene-7,7,9,9-tetramethyl-6-methylsulfanyldec-3-ene |
| SMILES | C/C=C(\C=C/CC)C(SC)C(C)(C)CC(C)(C)C.CC |
| InChI | InChI=1S/C17H32S.C2H6/c1-9-11-12-14(10-2)15(18-8)17(6,7)13-16(3,4)5;1-2/h10-12,15H,9,13H2,1-8H3;1-2H3/b12-11-,14-10+; |
| InChIKey | HGPZOSGYVQBKIU-APCLUODLSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.58 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|