C22H40N2O3 — CID 144509201
N-[3-methyl-1-oxo-1-[[(4S)-2,6,7-trimethyl-5-oxooct-7-en-4-yl]amino]butan-2-yl]hexanamide (PubChem CID 144509201) has the molecular formula C22H40N2O3 and a molecular weight of 380.57 g/mol. Its IUPAC name is N-[3-methyl-1-oxo-1-[[(4S)-2,6,7-trimethyl-5-oxooct-7-en-4-yl]amino]butan-2-yl]hexanamide.
| Compound Name | N-[3-methyl-1-oxo-1-[[(4S)-2,6,7-trimethyl-5-oxooct-7-en-4-yl]amino]butan-2-yl]hexanamide |
|---|---|
| PubChem CID | 144509201 |
| Molecular Formula | C22H40N2O3 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.30 |
| IUPAC Name | N-[3-methyl-1-oxo-1-[[(4S)-2,6,7-trimethyl-5-oxooct-7-en-4-yl]amino]butan-2-yl]hexanamide |
| SMILES | C=C(C)C(C)C(=O)[C@H](CC(C)C)NC(=O)C(NC(=O)CCCCC)C(C)C |
| InChI | InChI=1S/C22H40N2O3/c1-9-10-11-12-19(25)24-20(16(6)7)22(27)23-18(13-14(2)3)21(26)17(8)15(4)5/h14,16-18,20H,4,9-13H2,1-3,5-8H3,(H,23,27)(H,24,25)/t17?,18-,20?/m0/s1 |
| InChIKey | FFQGIMKCNTWDBV-FDYSRKEFSA-N |
| XLogP | 4.02 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|