C19H26FNO2 — CID 144509285
2-[(1E,3Z)-4-ethylhexa-1,3,5-trienoxy]-N-[(3-fluorocyclohexa-2,4-dien-1-yl)methyl]butanamide (PubChem CID 144509285) has the molecular formula C19H26FNO2 and a molecular weight of 319.42 g/mol. Its IUPAC name is 2-[(1E,3Z)-4-ethylhexa-1,3,5-trienoxy]-N-[(3-fluorocyclohexa-2,4-dien-1-yl)methyl]butanamide.
| Compound Name | 2-[(1E,3Z)-4-ethylhexa-1,3,5-trienoxy]-N-[(3-fluorocyclohexa-2,4-dien-1-yl)methyl]butanamide |
|---|---|
| PubChem CID | 144509285 |
| Molecular Formula | C19H26FNO2 |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 2-[(1E,3Z)-4-ethylhexa-1,3,5-trienoxy]-N-[(3-fluorocyclohexa-2,4-dien-1-yl)methyl]butanamide |
| SMILES | C=C/C(=C\C=C\OC(CC)C(=O)NCC1C=C(F)C=CC1)CC |
| InChI | InChI=1S/C19H26FNO2/c1-4-15(5-2)10-8-12-23-18(6-3)19(22)21-14-16-9-7-11-17(20)13-16/h4,7-8,10-13,16,18H,1,5-6,9,14H2,2-3H3,(H,21,22)/b12-8+,15-10+ |
| InChIKey | OYFXPLBFWZEXND-AMHPPWGGSA-N |
| XLogP | 4.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|