C23H36FNO3 — CID 144509298
ethane;2-[(1E,3E)-2-ethyl-4-fluorohexa-1,3,5-trienoxy]-N-[(3Z,5E)-5-methoxyhepta-3,5-dienyl]acetamide;prop-1-yne (PubChem CID 144509298) has the molecular formula C23H36FNO3 and a molecular weight of 393.54 g/mol. Its IUPAC name is ethane;2-[(1E,3E)-2-ethyl-4-fluorohexa-1,3,5-trienoxy]-N-[(3Z,5E)-5-methoxyhepta-3,5-dienyl]acetamide;prop-1-yne.
| Compound Name | ethane;2-[(1E,3E)-2-ethyl-4-fluorohexa-1,3,5-trienoxy]-N-[(3Z,5E)-5-methoxyhepta-3,5-dienyl]acetamide;prop-1-yne |
|---|---|
| PubChem CID | 144509298 |
| Molecular Formula | C23H36FNO3 |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | ethane;2-[(1E,3E)-2-ethyl-4-fluorohexa-1,3,5-trienoxy]-N-[(3Z,5E)-5-methoxyhepta-3,5-dienyl]acetamide;prop-1-yne |
| SMILES | C#CC.C=C/C(F)=C\C(=C\OCC(=O)NCC/C=C\C(=C/C)OC)CC.CC |
| InChI | InChI=1S/C18H26FNO3.C3H4.C2H6/c1-5-15(12-16(19)6-2)13-23-14-18(21)20-11-9-8-10-17(7-3)22-4;1-3-2;1-2/h6-8,10,12-13H,2,5,9,11,14H2,1,3-4H3,(H,20,21);1H,2H3;1-2H3/b10-8-,15-13+,16-12+,17-7+;; |
| InChIKey | SVRWYYKZTIJSMI-AHRLOVQQSA-N |
| XLogP | 5.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|