C32H53F4NO — CID 144510692
3-ethyl-2-fluoro-4-methylheptane;3-ethyl-2-propyl-5-(trifluoromethyl)pyridine;1-(2-methyl-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)ethanone (PubChem CID 144510692) has the molecular formula C32H53F4NO and a molecular weight of 543.77 g/mol. Its IUPAC name is 3-ethyl-2-fluoro-4-methylheptane;3-ethyl-2-propyl-5-(trifluoromethyl)pyridine;1-(2-methyl-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)ethanone.
| Compound Name | 3-ethyl-2-fluoro-4-methylheptane;3-ethyl-2-propyl-5-(trifluoromethyl)pyridine;1-(2-methyl-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)ethanone |
|---|---|
| PubChem CID | 144510692 |
| Molecular Formula | C32H53F4NO |
| Molecular Weight | 543.77 g/mol |
| Exact Mass | 543.41 |
| IUPAC Name | 3-ethyl-2-fluoro-4-methylheptane;3-ethyl-2-propyl-5-(trifluoromethyl)pyridine;1-(2-methyl-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)ethanone |
| SMILES | CC(=O)C12CCCC1CC(C)C2.CCCC(C)C(CC)C(C)F.CCCc1ncc(C(F)(F)F)cc1CC |
| InChI | InChI=1S/C11H14F3N.C11H18O.C10H21F/c1-3-5-10-8(4-2)6-9(7-15-10)11(12,13)14;1-8-6-10-4-3-5-11(10,7-8)9(2)12;1-5-7-8(3)10(6-2)9(4)11/h6-7H,3-5H2,1-2H3;8,10H,3-7H2,1-2H3;8-10H,5-7H2,1-4H3 |
| InChIKey | OCNAZFLNMJFZNR-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.77 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |