About (E)-N,3,4-trimethylhex-3-en-5-yn-2-imine
(E)-N,3,4-trimethylhex-3-en-5-yn-2-imine (PubChem CID 144510901) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is (E)-N,3,4-trimethylhex-3-en-5-yn-2-imine.
Molecular Properties
| Compound Name | (E)-N,3,4-trimethylhex-3-en-5-yn-2-imine |
| PubChem CID | 144510901 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (E)-N,3,4-trimethylhex-3-en-5-yn-2-imine |
| SMILES | C#C/C(C)=C(C)/C(C)=N/C |
| InChI | InChI=1S/C9H13N/c1-6-7(2)8(3)9(4)10-5/h1H,2-5H3/b8-7+,10-9+ |
| InChIKey | UMYKWKSQIHDIOL-XBLVEGMJSA-N |
| XLogP | 2.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,3,4-trimethylhex-3-en-5-yn-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,3,4-trimethylhex-3-en-5-yn-2-imine?
The IUPAC name of (E)-N,3,4-trimethylhex-3-en-5-yn-2-imine (CID 144510901) is (E)-N,3,4-trimethylhex-3-en-5-yn-2-imine.
What is the SMILES notation for (E)-N,3,4-trimethylhex-3-en-5-yn-2-imine?
The canonical SMILES for (E)-N,3,4-trimethylhex-3-en-5-yn-2-imine is C#C/C(C)=C(C)/C(C)=N/C.
What is the InChIKey of (E)-N,3,4-trimethylhex-3-en-5-yn-2-imine?
The InChIKey is UMYKWKSQIHDIOL-XBLVEGMJSA-N. The full InChI is InChI=1S/C9H13N/c1-6-7(2)8(3)9(4)10-5/h1H,2-5H3/b8-7+,10-9+.
What are the key properties of (E)-N,3,4-trimethylhex-3-en-5-yn-2-imine?
(E)-N,3,4-trimethylhex-3-en-5-yn-2-imine has a molecular weight of 135.21 g/mol, XLogP of 2.05, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,3,4-trimethylhex-3-en-5-yn-2-imine is sourced from PubChem (CID 144510901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).