C15H23NOS — CID 144510905
ethane;3-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-4,5-dimethyl-1,3-thiazol-2-one (PubChem CID 144510905) has the molecular formula C15H23NOS and a molecular weight of 265.42 g/mol. Its IUPAC name is ethane;3-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-4,5-dimethyl-1,3-thiazol-2-one.
| Compound Name | ethane;3-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-4,5-dimethyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 144510905 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | ethane;3-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-4,5-dimethyl-1,3-thiazol-2-one |
| SMILES | C=C/C(=C\C=C/C)Cn1c(C)c(C)sc1=O.CC |
| InChI | InChI=1S/C13H17NOS.C2H6/c1-5-7-8-12(6-2)9-14-10(3)11(4)16-13(14)15;1-2/h5-8H,2,9H2,1,3-4H3;1-2H3/b7-5-,12-8+; |
| InChIKey | AJPCQZLOUAZJGN-LOLBUNACSA-N |
| XLogP | 4.24 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|