About (Z)-N,2-diethyl-4,4-difluoro-N-methyl-3-methylidenepent-1-en-1-amine;ethane
(Z)-N,2-diethyl-4,4-difluoro-N-methyl-3-methylidenepent-1-en-1-amine;ethane (PubChem CID 144510947) has the molecular formula C13H25F2N
and a molecular weight of 233.35 g/mol. Its IUPAC name is (Z)-N,2-diethyl-4,4-difluoro-N-methyl-3-methylidenepent-1-en-1-amine;ethane.
Molecular Properties
| Compound Name | (Z)-N,2-diethyl-4,4-difluoro-N-methyl-3-methylidenepent-1-en-1-amine;ethane |
| PubChem CID | 144510947 |
| Molecular Formula | C13H25F2N |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | (Z)-N,2-diethyl-4,4-difluoro-N-methyl-3-methylidenepent-1-en-1-amine;ethane |
| SMILES | C=C(/C(=C\N(C)CC)CC)C(C)(F)F.CC |
| InChI | InChI=1S/C11H19F2N.C2H6/c1-6-10(8-14(5)7-2)9(3)11(4,12)13;1-2/h8H,3,6-7H2,1-2,4-5H3;1-2H3/b10-8-; |
| InChIKey | VDHUDNHIKVHTPA-DQMXGCRQSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,2-diethyl-4,4-difluoro-N-methyl-3-methylidenepent-1-en-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,2-diethyl-4,4-difluoro-N-methyl-3-methylidenepent-1-en-1-amine;ethane?
The IUPAC name of (Z)-N,2-diethyl-4,4-difluoro-N-methyl-3-methylidenepent-1-en-1-amine;ethane (CID 144510947) is (Z)-N,2-diethyl-4,4-difluoro-N-methyl-3-methylidenepent-1-en-1-amine;ethane.
What is the SMILES notation for (Z)-N,2-diethyl-4,4-difluoro-N-methyl-3-methylidenepent-1-en-1-amine;ethane?
The canonical SMILES for (Z)-N,2-diethyl-4,4-difluoro-N-methyl-3-methylidenepent-1-en-1-amine;ethane is C=C(/C(=C\N(C)CC)CC)C(C)(F)F.CC.
What is the InChIKey of (Z)-N,2-diethyl-4,4-difluoro-N-methyl-3-methylidenepent-1-en-1-amine;ethane?
The InChIKey is VDHUDNHIKVHTPA-DQMXGCRQSA-N. The full InChI is InChI=1S/C11H19F2N.C2H6/c1-6-10(8-14(5)7-2)9(3)11(4,12)13;1-2/h8H,3,6-7H2,1-2,4-5H3;1-2H3/b10-8-;.
What are the key properties of (Z)-N,2-diethyl-4,4-difluoro-N-methyl-3-methylidenepent-1-en-1-amine;ethane?
(Z)-N,2-diethyl-4,4-difluoro-N-methyl-3-methylidenepent-1-en-1-amine;ethane has a molecular weight of 233.35 g/mol, XLogP of 4.47, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,2-diethyl-4,4-difluoro-N-methyl-3-methylidenepent-1-en-1-amine;ethane is sourced from PubChem (CID 144510947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).