About (Z)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine
(Z)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine (PubChem CID 144510963) has the molecular formula C8H14FN
and a molecular weight of 143.20 g/mol. Its IUPAC name is (Z)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine |
| PubChem CID | 144510963 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | (Z)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine |
| SMILES | C=C(/C(C)=C\NC)C(C)F |
| InChI | InChI=1S/C8H14FN/c1-6(5-10-4)7(2)8(3)9/h5,8,10H,2H2,1,3-4H3/b6-5- |
| InChIKey | HIFVFKISWDDJLG-WAYWQWQTSA-N |
| XLogP | 2.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine?
The IUPAC name of (Z)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine (CID 144510963) is (Z)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine.
What is the SMILES notation for (Z)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine?
The canonical SMILES for (Z)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine is C=C(/C(C)=C\NC)C(C)F.
What is the InChIKey of (Z)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine?
The InChIKey is HIFVFKISWDDJLG-WAYWQWQTSA-N. The full InChI is InChI=1S/C8H14FN/c1-6(5-10-4)7(2)8(3)9/h5,8,10H,2H2,1,3-4H3/b6-5-.
What are the key properties of (Z)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine?
(Z)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine has a molecular weight of 143.20 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine is sourced from PubChem (CID 144510963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).