C23H49N3O2 — CID 144511599
1,11-dihydroxy-3,4,8,8,13,13,15,15-octamethyl-1,6,11-triazacyclohexadec-2-ene;ethane (PubChem CID 144511599) has the molecular formula C23H49N3O2 and a molecular weight of 399.66 g/mol. Its IUPAC name is 1,11-dihydroxy-3,4,8,8,13,13,15,15-octamethyl-1,6,11-triazacyclohexadec-2-ene;ethane.
| Compound Name | 1,11-dihydroxy-3,4,8,8,13,13,15,15-octamethyl-1,6,11-triazacyclohexadec-2-ene;ethane |
|---|---|
| PubChem CID | 144511599 |
| Molecular Formula | C23H49N3O2 |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 399.38 |
| IUPAC Name | 1,11-dihydroxy-3,4,8,8,13,13,15,15-octamethyl-1,6,11-triazacyclohexadec-2-ene;ethane |
| SMILES | CC.CC1=CN(O)CC(C)(C)CC(C)(C)CN(O)CCC(C)(C)CNCC1C |
| InChI | InChI=1S/C21H43N3O2.C2H6/c1-17-11-22-14-19(3,4)9-10-23(25)15-20(5,6)13-21(7,8)16-24(26)12-18(17)2;1-2/h12,17,22,25-26H,9-11,13-16H2,1-8H3;1-2H3 |
| InChIKey | ABJFFTUDBVPJNX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |