About 2-methylcyclopentan-1-ol;2-methyl-1,3-dioxolane-2-carbaldehyde;2-methylpropan-2-ol
2-methylcyclopentan-1-ol;2-methyl-1,3-dioxolane-2-carbaldehyde;2-methylpropan-2-ol (PubChem CID 144511692) has the molecular formula C15H30O5
and a molecular weight of 290.40 g/mol. Its IUPAC name is 2-methylcyclopentan-1-ol;2-methyl-1,3-dioxolane-2-carbaldehyde;2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 2-methylcyclopentan-1-ol;2-methyl-1,3-dioxolane-2-carbaldehyde;2-methylpropan-2-ol |
| PubChem CID | 144511692 |
| Molecular Formula | C15H30O5 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 2-methylcyclopentan-1-ol;2-methyl-1,3-dioxolane-2-carbaldehyde;2-methylpropan-2-ol |
| SMILES | CC(C)(C)O.CC1(C=O)OCCO1.CC1CCCC1O |
| InChI | InChI=1S/C6H12O.C5H8O3.C4H10O/c1-5-3-2-4-6(5)7;1-5(4-6)7-2-3-8-5;1-4(2,3)5/h5-7H,2-4H2,1H3;4H,2-3H2,1H3;5H,1-3H3 |
| InChIKey | HDRULXYOLLRSFY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methylcyclopentan-1-ol;2-methyl-1,3-dioxolane-2-carbaldehyde;2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylcyclopentan-1-ol;2-methyl-1,3-dioxolane-2-carbaldehyde;2-methylpropan-2-ol?
The IUPAC name of 2-methylcyclopentan-1-ol;2-methyl-1,3-dioxolane-2-carbaldehyde;2-methylpropan-2-ol (CID 144511692) is 2-methylcyclopentan-1-ol;2-methyl-1,3-dioxolane-2-carbaldehyde;2-methylpropan-2-ol.
What is the SMILES notation for 2-methylcyclopentan-1-ol;2-methyl-1,3-dioxolane-2-carbaldehyde;2-methylpropan-2-ol?
The canonical SMILES for 2-methylcyclopentan-1-ol;2-methyl-1,3-dioxolane-2-carbaldehyde;2-methylpropan-2-ol is CC(C)(C)O.CC1(C=O)OCCO1.CC1CCCC1O.
What is the InChIKey of 2-methylcyclopentan-1-ol;2-methyl-1,3-dioxolane-2-carbaldehyde;2-methylpropan-2-ol?
The InChIKey is HDRULXYOLLRSFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C5H8O3.C4H10O/c1-5-3-2-4-6(5)7;1-5(4-6)7-2-3-8-5;1-4(2,3)5/h5-7H,2-4H2,1H3;4H,2-3H2,1H3;5H,1-3H3.
What are the key properties of 2-methylcyclopentan-1-ol;2-methyl-1,3-dioxolane-2-carbaldehyde;2-methylpropan-2-ol?
2-methylcyclopentan-1-ol;2-methyl-1,3-dioxolane-2-carbaldehyde;2-methylpropan-2-ol has a molecular weight of 290.40 g/mol, XLogP of 1.89, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylcyclopentan-1-ol;2-methyl-1,3-dioxolane-2-carbaldehyde;2-methylpropan-2-ol is sourced from PubChem (CID 144511692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).