About methane;N-methyl-3-methylidenepentan-1-imine
methane;N-methyl-3-methylidenepentan-1-imine (PubChem CID 144512385) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is methane;N-methyl-3-methylidenepentan-1-imine.
Molecular Properties
| Compound Name | methane;N-methyl-3-methylidenepentan-1-imine |
| PubChem CID | 144512385 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | methane;N-methyl-3-methylidenepentan-1-imine |
| SMILES | C.C=C(CC)C/C=N/C |
| InChI | InChI=1S/C7H13N.CH4/c1-4-7(2)5-6-8-3;/h6H,2,4-5H2,1,3H3;1H4/b8-6+; |
| InChIKey | RMKUSICLQGYLEY-WVLIHFOGSA-N |
| XLogP | 2.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;N-methyl-3-methylidenepentan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;N-methyl-3-methylidenepentan-1-imine?
The IUPAC name of methane;N-methyl-3-methylidenepentan-1-imine (CID 144512385) is methane;N-methyl-3-methylidenepentan-1-imine.
What is the SMILES notation for methane;N-methyl-3-methylidenepentan-1-imine?
The canonical SMILES for methane;N-methyl-3-methylidenepentan-1-imine is C.C=C(CC)C/C=N/C.
What is the InChIKey of methane;N-methyl-3-methylidenepentan-1-imine?
The InChIKey is RMKUSICLQGYLEY-WVLIHFOGSA-N. The full InChI is InChI=1S/C7H13N.CH4/c1-4-7(2)5-6-8-3;/h6H,2,4-5H2,1,3H3;1H4/b8-6+;.
What are the key properties of methane;N-methyl-3-methylidenepentan-1-imine?
methane;N-methyl-3-methylidenepentan-1-imine has a molecular weight of 127.23 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;N-methyl-3-methylidenepentan-1-imine is sourced from PubChem (CID 144512385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).