C23H27N — CID 144512574
(1E,3Z)-5-[2-(1,2-dimethylcyclopropyl)phenyl]-3-methyl-2-phenylpenta-1,3-dien-1-amine (PubChem CID 144512574) has the molecular formula C23H27N and a molecular weight of 317.48 g/mol. Its IUPAC name is (1E,3Z)-5-[2-(1,2-dimethylcyclopropyl)phenyl]-3-methyl-2-phenylpenta-1,3-dien-1-amine.
| Compound Name | (1E,3Z)-5-[2-(1,2-dimethylcyclopropyl)phenyl]-3-methyl-2-phenylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144512574 |
| Molecular Formula | C23H27N |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | (1E,3Z)-5-[2-(1,2-dimethylcyclopropyl)phenyl]-3-methyl-2-phenylpenta-1,3-dien-1-amine |
| SMILES | CC(=C/Cc1ccccc1C1(C)CC1C)/C(=C\N)c1ccccc1 |
| InChI | InChI=1S/C23H27N/c1-17(21(16-24)19-9-5-4-6-10-19)13-14-20-11-7-8-12-22(20)23(3)15-18(23)2/h4-13,16,18H,14-15,24H2,1-3H3/b17-13-,21-16+ |
| InChIKey | XOJYOIYTERUCQR-KMGBFVISSA-N |
| XLogP | 5.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|