C14H14N2O2 — CID 144512977
1,4-diamino-1,2,3,9a-tetrahydroanthracene-9,10-dione (PubChem CID 144512977) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 1,4-diamino-1,2,3,9a-tetrahydroanthracene-9,10-dione.
| Compound Name | 1,4-diamino-1,2,3,9a-tetrahydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 144512977 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1,4-diamino-1,2,3,9a-tetrahydroanthracene-9,10-dione |
| SMILES | NC1=C2C(=O)c3ccccc3C(=O)C2C(N)CC1 |
| InChI | InChI=1S/C14H14N2O2/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-4,9,11H,5-6,15-16H2 |
| InChIKey | CUCSJDFZZTXUMG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|