C15H25N — CID 144512992
(3E,5Z)-N-butyl-N-ethyl-6-methylocta-1,3,5,7-tetraen-3-amine (PubChem CID 144512992) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is (3E,5Z)-N-butyl-N-ethyl-6-methylocta-1,3,5,7-tetraen-3-amine.
| Compound Name | (3E,5Z)-N-butyl-N-ethyl-6-methylocta-1,3,5,7-tetraen-3-amine |
|---|---|
| PubChem CID | 144512992 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | (3E,5Z)-N-butyl-N-ethyl-6-methylocta-1,3,5,7-tetraen-3-amine |
| SMILES | C=C/C(C)=C\C=C(/C=C)N(CC)CCCC |
| InChI | InChI=1S/C15H25N/c1-6-10-13-16(9-4)15(8-3)12-11-14(5)7-2/h7-8,11-12H,2-3,6,9-10,13H2,1,4-5H3/b14-11-,15-12+ |
| InChIKey | COXIRVZOQYFIPF-KMUHKHSISA-N |
| XLogP | 4.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|