About 2-(dimethyl-λ3-iodanyl)guanidine
2-(dimethyl-λ3-iodanyl)guanidine (PubChem CID 144513029) has the molecular formula C3H10IN3
and a molecular weight of 215.04 g/mol. Its IUPAC name is 2-(dimethyl-λ3-iodanyl)guanidine.
Molecular Properties
| Compound Name | 2-(dimethyl-λ3-iodanyl)guanidine |
| PubChem CID | 144513029 |
| Molecular Formula | C3H10IN3 |
| Molecular Weight | 215.04 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 2-(dimethyl-λ3-iodanyl)guanidine |
| SMILES | CI(C)N=C(N)N |
| InChI | InChI=1S/C3H10IN3/c1-4(2)7-3(5)6/h1-2H3,(H4,5,6,7) |
| InChIKey | RERKDIPBOPHUND-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.04 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethyl-λ3-iodanyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethyl-λ3-iodanyl)guanidine?
The IUPAC name of 2-(dimethyl-λ3-iodanyl)guanidine (CID 144513029) is 2-(dimethyl-λ3-iodanyl)guanidine.
What is the SMILES notation for 2-(dimethyl-λ3-iodanyl)guanidine?
The canonical SMILES for 2-(dimethyl-λ3-iodanyl)guanidine is CI(C)N=C(N)N.
What is the InChIKey of 2-(dimethyl-λ3-iodanyl)guanidine?
The InChIKey is RERKDIPBOPHUND-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10IN3/c1-4(2)7-3(5)6/h1-2H3,(H4,5,6,7).
What are the key properties of 2-(dimethyl-λ3-iodanyl)guanidine?
2-(dimethyl-λ3-iodanyl)guanidine has a molecular weight of 215.04 g/mol, XLogP of -0.06, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethyl-λ3-iodanyl)guanidine is sourced from PubChem (CID 144513029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).