C22H31FS — CID 144513074
4-[(1E,3Z)-2-ethylhexa-1,3-dienyl]-1-fluoro-7-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methyl-2,3-dihydrothiepine (PubChem CID 144513074) has the molecular formula C22H31FS and a molecular weight of 346.56 g/mol. Its IUPAC name is 4-[(1E,3Z)-2-ethylhexa-1,3-dienyl]-1-fluoro-7-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methyl-2,3-dihydrothiepine.
| Compound Name | 4-[(1E,3Z)-2-ethylhexa-1,3-dienyl]-1-fluoro-7-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methyl-2,3-dihydrothiepine |
|---|---|
| PubChem CID | 144513074 |
| Molecular Formula | C22H31FS |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 4-[(1E,3Z)-2-ethylhexa-1,3-dienyl]-1-fluoro-7-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methyl-2,3-dihydrothiepine |
| SMILES | C=C(/C=C\C=C/C)C1=CC=C(/C=C(/C=C\CC)CC)CCS1(C)F |
| InChI | InChI=1S/C22H31FS/c1-6-9-11-12-19(4)22-15-14-21(16-17-24(22,5)23)18-20(8-3)13-10-7-2/h6,9-15,18H,4,7-8,16-17H2,1-3,5H3/b9-6-,12-11-,13-10-,20-18+ |
| InChIKey | WEKGDQXTRTUEGU-PBFGVSABSA-N |
| XLogP | 7.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|