About 1-methyl-4-nitro-1-azacyclohepta-2,3,5,6-tetraene
1-methyl-4-nitro-1-azacyclohepta-2,3,5,6-tetraene (PubChem CID 144513097) has the molecular formula C7H6N2O2
and a molecular weight of 150.14 g/mol. Its IUPAC name is 1-methyl-4-nitro-1-azacyclohepta-2,3,5,6-tetraene.
Molecular Properties
| Compound Name | 1-methyl-4-nitro-1-azacyclohepta-2,3,5,6-tetraene |
| PubChem CID | 144513097 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 1-methyl-4-nitro-1-azacyclohepta-2,3,5,6-tetraene |
| SMILES | CN1C=C=CC([N+](=O)[O-])=C=C1 |
| InChI | InChI=1S/C7H6N2O2/c1-8-5-2-3-7(4-6-8)9(10)11/h3,5-6H,1H3 |
| InChIKey | MUZIJRHLHIESSS-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-nitro-1-azacyclohepta-2,3,5,6-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-nitro-1-azacyclohepta-2,3,5,6-tetraene?
The IUPAC name of 1-methyl-4-nitro-1-azacyclohepta-2,3,5,6-tetraene (CID 144513097) is 1-methyl-4-nitro-1-azacyclohepta-2,3,5,6-tetraene.
What is the SMILES notation for 1-methyl-4-nitro-1-azacyclohepta-2,3,5,6-tetraene?
The canonical SMILES for 1-methyl-4-nitro-1-azacyclohepta-2,3,5,6-tetraene is CN1C=C=CC([N+](=O)[O-])=C=C1.
What is the InChIKey of 1-methyl-4-nitro-1-azacyclohepta-2,3,5,6-tetraene?
The InChIKey is MUZIJRHLHIESSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2/c1-8-5-2-3-7(4-6-8)9(10)11/h3,5-6H,1H3.
What are the key properties of 1-methyl-4-nitro-1-azacyclohepta-2,3,5,6-tetraene?
1-methyl-4-nitro-1-azacyclohepta-2,3,5,6-tetraene has a molecular weight of 150.14 g/mol, XLogP of 0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-nitro-1-azacyclohepta-2,3,5,6-tetraene is sourced from PubChem (CID 144513097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).