C28H32F3N7O2 — CID 144513267
3-[2-[methyl-[(1R,2R)-2-[[(1R,4R,6S)-2-[5-(trifluoromethyl)pyrazin-2-yl]-2-azabicyclo[2.2.1]heptan-6-yl]amino]cyclohexyl]amino]-1,3-oxazol-5-yl]benzamide (PubChem CID 144513267) has the molecular formula C28H32F3N7O2 and a molecular weight of 555.61 g/mol. Its IUPAC name is 3-[2-[methyl-[(1R,2R)-2-[[(1R,4R,6S)-2-[5-(trifluoromethyl)pyrazin-2-yl]-2-azabicyclo[2.2.1]heptan-6-yl]amino]cyclohexyl]amino]-1,3-oxazol-5-yl]benzamide.
| Compound Name | 3-[2-[methyl-[(1R,2R)-2-[[(1R,4R,6S)-2-[5-(trifluoromethyl)pyrazin-2-yl]-2-azabicyclo[2.2.1]heptan-6-yl]amino]cyclohexyl]amino]-1,3-oxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 144513267 |
| Molecular Formula | C28H32F3N7O2 |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 3-[2-[methyl-[(1R,2R)-2-[[(1R,4R,6S)-2-[5-(trifluoromethyl)pyrazin-2-yl]-2-azabicyclo[2.2.1]heptan-6-yl]amino]cyclohexyl]amino]-1,3-oxazol-5-yl]benzamide |
| SMILES | CN(c1ncc(-c2cccc(C(N)=O)c2)o1)[C@@H]1CCCC[C@H]1N[C@H]1C[C@@H]2C[C@H]1N(c1cnc(C(F)(F)F)cn1)C2 |
| InChI | InChI=1S/C28H32F3N7O2/c1-37(27-35-12-23(40-27)17-5-4-6-18(11-17)26(32)39)21-8-3-2-7-19(21)36-20-9-16-10-22(20)38(15-16)25-14-33-24(13-34-25)28(29,30)31/h4-6,11-14,16,19-22,36H,2-3,7-10,15H2,1H3,(H2,32,39)/t16-,19-,20+,21-,22-/m1/s1 |
| InChIKey | LYULHNZUMAZKGI-RECXWPGBSA-N |
| XLogP | 4.25 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |