C45H64F3N — CID 144513975
1-butyl-2-(trifluoromethyl)benzene;2-cyclopropyl-5-[5-(11-methyldodeca-1,11-dien-2-yl)-2-pentan-2-ylphenyl]-3H-pyrrole;prop-1-ene (PubChem CID 144513975) has the molecular formula C45H64F3N and a molecular weight of 676.01 g/mol. Its IUPAC name is 1-butyl-2-(trifluoromethyl)benzene;2-cyclopropyl-5-[5-(11-methyldodeca-1,11-dien-2-yl)-2-pentan-2-ylphenyl]-3H-pyrrole;prop-1-ene.
| Compound Name | 1-butyl-2-(trifluoromethyl)benzene;2-cyclopropyl-5-[5-(11-methyldodeca-1,11-dien-2-yl)-2-pentan-2-ylphenyl]-3H-pyrrole;prop-1-ene |
|---|---|
| PubChem CID | 144513975 |
| Molecular Formula | C45H64F3N |
| Molecular Weight | 676.01 g/mol |
| Exact Mass | 675.50 |
| IUPAC Name | 1-butyl-2-(trifluoromethyl)benzene;2-cyclopropyl-5-[5-(11-methyldodeca-1,11-dien-2-yl)-2-pentan-2-ylphenyl]-3H-pyrrole;prop-1-ene |
| SMILES | C=C(C)CCCCCCCCC(=C)c1ccc(C(C)CCC)c(C2=CCC(C3CC3)=N2)c1.C=CC.CCCCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C31H45N.C11H13F3.C3H6/c1-6-13-25(5)28-19-18-27(22-29(28)31-21-20-30(32-31)26-16-17-26)24(4)15-12-10-8-7-9-11-14-23(2)3;1-2-3-6-9-7-4-5-8-10(9)11(12,13)14;1-3-2/h18-19,21-22,25-26H,2,4,6-17,20H2,1,3,5H3;4-5,7-8H,2-3,6H2,1H3;3H,1H2,2H3 |
| InChIKey | QIIKHQLHEINQTP-UHFFFAOYSA-N |
| XLogP | 15.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.01 |
| LogP ≤ 5 | 15.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|