C19H24N2S — CID 144514179
N-[1-[4-methyl-3-[2-(1,3-thiazol-4-yl)prop-2-enyl]phenyl]ethenyl]butan-1-amine (PubChem CID 144514179) has the molecular formula C19H24N2S and a molecular weight of 312.48 g/mol. Its IUPAC name is N-[1-[4-methyl-3-[2-(1,3-thiazol-4-yl)prop-2-enyl]phenyl]ethenyl]butan-1-amine.
| Compound Name | N-[1-[4-methyl-3-[2-(1,3-thiazol-4-yl)prop-2-enyl]phenyl]ethenyl]butan-1-amine |
|---|---|
| PubChem CID | 144514179 |
| Molecular Formula | C19H24N2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | N-[1-[4-methyl-3-[2-(1,3-thiazol-4-yl)prop-2-enyl]phenyl]ethenyl]butan-1-amine |
| SMILES | C=C(NCCCC)c1ccc(C)c(CC(=C)c2cscn2)c1 |
| InChI | InChI=1S/C19H24N2S/c1-5-6-9-20-16(4)17-8-7-14(2)18(11-17)10-15(3)19-12-22-13-21-19/h7-8,11-13,20H,3-6,9-10H2,1-2H3 |
| InChIKey | PMLMLSHDELINGM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|