C13H23F — CID 144514392
1-fluorobutane;propane;(4R,5S)-tricyclo[3.1.0.02,4]hex-1-ene (PubChem CID 144514392) has the molecular formula C13H23F and a molecular weight of 198.32 g/mol. Its IUPAC name is 1-fluorobutane;propane;(4R,5S)-tricyclo[3.1.0.02,4]hex-1-ene.
| Compound Name | 1-fluorobutane;propane;(4R,5S)-tricyclo[3.1.0.02,4]hex-1-ene |
|---|---|
| PubChem CID | 144514392 |
| Molecular Formula | C13H23F |
| Molecular Weight | 198.32 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | 1-fluorobutane;propane;(4R,5S)-tricyclo[3.1.0.02,4]hex-1-ene |
| SMILES | C1C2=C3C[C@@H]3[C@H]12.CCC.CCCCF |
| InChI | InChI=1S/C6H6.C4H9F.C3H8/c1-3-4(1)6-2-5(3)6;1-2-3-4-5;1-3-2/h3,5H,1-2H2;2-4H2,1H3;3H2,1-2H3/t3-,5-;; |
| InChIKey | BKECXMLUDKGSSD-ZNQUJQIJSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|