C12H22 — CID 144514446
(E)-2,3,6,6-tetramethyl-5-methylidenehept-3-ene (PubChem CID 144514446) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is (E)-2,3,6,6-tetramethyl-5-methylidenehept-3-ene.
| Compound Name | (E)-2,3,6,6-tetramethyl-5-methylidenehept-3-ene |
|---|---|
| PubChem CID | 144514446 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | (E)-2,3,6,6-tetramethyl-5-methylidenehept-3-ene |
| SMILES | C=C(/C=C(\C)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H22/c1-9(2)10(3)8-11(4)12(5,6)7/h8-9H,4H2,1-3,5-7H3/b10-8+ |
| InChIKey | ATXWCUIGPLNFBM-CSKARUKUSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|