About ethane;8-methylimidazo[1,2-b]pyridazine;N-(2-prop-1-en-2-ylpyrazol-3-yl)methanimine
ethane;8-methylimidazo[1,2-b]pyridazine;N-(2-prop-1-en-2-ylpyrazol-3-yl)methanimine (PubChem CID 144514706) has the molecular formula C18H28N6
and a molecular weight of 328.46 g/mol. Its IUPAC name is ethane;8-methylimidazo[1,2-b]pyridazine;N-(2-prop-1-en-2-ylpyrazol-3-yl)methanimine.
Molecular Properties
| Compound Name | ethane;8-methylimidazo[1,2-b]pyridazine;N-(2-prop-1-en-2-ylpyrazol-3-yl)methanimine |
| PubChem CID | 144514706 |
| Molecular Formula | C18H28N6 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | ethane;8-methylimidazo[1,2-b]pyridazine;N-(2-prop-1-en-2-ylpyrazol-3-yl)methanimine |
| SMILES | C=Nc1ccnn1C(=C)C.CC.CC.Cc1ccnn2ccnc12 |
| InChI | InChI=1S/C7H7N3.C7H9N3.2C2H6/c1-6-2-3-9-10-5-4-8-7(6)10;1-6(2)10-7(8-3)4-5-9-10;2*1-2/h2-5H,1H3;4-5H,1,3H2,2H3;2*1-2H3 |
| InChIKey | PNLLXVKZISQFOG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;8-methylimidazo[1,2-b]pyridazine;N-(2-prop-1-en-2-ylpyrazol-3-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;8-methylimidazo[1,2-b]pyridazine;N-(2-prop-1-en-2-ylpyrazol-3-yl)methanimine?
The IUPAC name of ethane;8-methylimidazo[1,2-b]pyridazine;N-(2-prop-1-en-2-ylpyrazol-3-yl)methanimine (CID 144514706) is ethane;8-methylimidazo[1,2-b]pyridazine;N-(2-prop-1-en-2-ylpyrazol-3-yl)methanimine.
What is the SMILES notation for ethane;8-methylimidazo[1,2-b]pyridazine;N-(2-prop-1-en-2-ylpyrazol-3-yl)methanimine?
The canonical SMILES for ethane;8-methylimidazo[1,2-b]pyridazine;N-(2-prop-1-en-2-ylpyrazol-3-yl)methanimine is C=Nc1ccnn1C(=C)C.CC.CC.Cc1ccnn2ccnc12.
What is the InChIKey of ethane;8-methylimidazo[1,2-b]pyridazine;N-(2-prop-1-en-2-ylpyrazol-3-yl)methanimine?
The InChIKey is PNLLXVKZISQFOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.C7H9N3.2C2H6/c1-6-2-3-9-10-5-4-8-7(6)10;1-6(2)10-7(8-3)4-5-9-10;2*1-2/h2-5H,1H3;4-5H,1,3H2,2H3;2*1-2H3.
What are the key properties of ethane;8-methylimidazo[1,2-b]pyridazine;N-(2-prop-1-en-2-ylpyrazol-3-yl)methanimine?
ethane;8-methylimidazo[1,2-b]pyridazine;N-(2-prop-1-en-2-ylpyrazol-3-yl)methanimine has a molecular weight of 328.46 g/mol, XLogP of 4.80, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;8-methylimidazo[1,2-b]pyridazine;N-(2-prop-1-en-2-ylpyrazol-3-yl)methanimine is sourced from PubChem (CID 144514706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).