About 1,5-diphenyl-1,2,4-triazol-3-amine
1,5-diphenyl-1,2,4-triazol-3-amine (PubChem CID 14451471) has the molecular formula C14H12N4
and a molecular weight of 236.28 g/mol. Its IUPAC name is 1,5-diphenyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 1,5-diphenyl-1,2,4-triazol-3-amine |
| PubChem CID | 14451471 |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 1,5-diphenyl-1,2,4-triazol-3-amine |
| SMILES | Nc1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H12N4/c15-14-16-13(11-7-3-1-4-8-11)18(17-14)12-9-5-2-6-10-12/h1-10H,(H2,15,17) |
| InChIKey | HNMMJXSXQSISNR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,5-diphenyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diphenyl-1,2,4-triazol-3-amine?
The IUPAC name of 1,5-diphenyl-1,2,4-triazol-3-amine (CID 14451471) is 1,5-diphenyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 1,5-diphenyl-1,2,4-triazol-3-amine?
The canonical SMILES for 1,5-diphenyl-1,2,4-triazol-3-amine is Nc1nc(-c2ccccc2)n(-c2ccccc2)n1.
What is the InChIKey of 1,5-diphenyl-1,2,4-triazol-3-amine?
The InChIKey is HNMMJXSXQSISNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4/c15-14-16-13(11-7-3-1-4-8-11)18(17-14)12-9-5-2-6-10-12/h1-10H,(H2,15,17).
What are the key properties of 1,5-diphenyl-1,2,4-triazol-3-amine?
1,5-diphenyl-1,2,4-triazol-3-amine has a molecular weight of 236.28 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diphenyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 14451471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).