About acetylene;6-aminohexane-1,3,4-triol;methanol
acetylene;6-aminohexane-1,3,4-triol;methanol (PubChem CID 144515010) has the molecular formula C9H21NO4
and a molecular weight of 207.27 g/mol. Its IUPAC name is acetylene;6-aminohexane-1,3,4-triol;methanol.
Molecular Properties
| Compound Name | acetylene;6-aminohexane-1,3,4-triol;methanol |
| PubChem CID | 144515010 |
| Molecular Formula | C9H21NO4 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | acetylene;6-aminohexane-1,3,4-triol;methanol |
| SMILES | C#C.CO.NCCC(O)C(O)CCO |
| InChI | InChI=1S/C6H15NO3.C2H2.CH4O/c7-3-1-5(9)6(10)2-4-8;2*1-2/h5-6,8-10H,1-4,7H2;1-2H;2H,1H3 |
| InChIKey | JTAKBCRASHECAD-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;6-aminohexane-1,3,4-triol;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;6-aminohexane-1,3,4-triol;methanol?
The IUPAC name of acetylene;6-aminohexane-1,3,4-triol;methanol (CID 144515010) is acetylene;6-aminohexane-1,3,4-triol;methanol.
What is the SMILES notation for acetylene;6-aminohexane-1,3,4-triol;methanol?
The canonical SMILES for acetylene;6-aminohexane-1,3,4-triol;methanol is C#C.CO.NCCC(O)C(O)CCO.
What is the InChIKey of acetylene;6-aminohexane-1,3,4-triol;methanol?
The InChIKey is JTAKBCRASHECAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.C2H2.CH4O/c7-3-1-5(9)6(10)2-4-8;2*1-2/h5-6,8-10H,1-4,7H2;1-2H;2H,1H3.
What are the key properties of acetylene;6-aminohexane-1,3,4-triol;methanol?
acetylene;6-aminohexane-1,3,4-triol;methanol has a molecular weight of 207.27 g/mol, XLogP of -1.70, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;6-aminohexane-1,3,4-triol;methanol is sourced from PubChem (CID 144515010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).