About ethene;N-heptyl-2-methylpyrimidine-5-carboxamide;molecular hydrogen
ethene;N-heptyl-2-methylpyrimidine-5-carboxamide;molecular hydrogen (PubChem CID 144515256) has the molecular formula C15H27N3O
and a molecular weight of 265.40 g/mol. Its IUPAC name is ethene;N-heptyl-2-methylpyrimidine-5-carboxamide;molecular hydrogen.
Molecular Properties
| Compound Name | ethene;N-heptyl-2-methylpyrimidine-5-carboxamide;molecular hydrogen |
| PubChem CID | 144515256 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | ethene;N-heptyl-2-methylpyrimidine-5-carboxamide;molecular hydrogen |
| SMILES | C=C.CCCCCCCNC(=O)c1cnc(C)nc1.[H][H] |
| InChI | InChI=1S/C13H21N3O.C2H4.H2/c1-3-4-5-6-7-8-14-13(17)12-9-15-11(2)16-10-12;1-2;/h9-10H,3-8H2,1-2H3,(H,14,17);1-2H2;1H |
| InChIKey | BJYWPOTXRFNADL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;N-heptyl-2-methylpyrimidine-5-carboxamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;N-heptyl-2-methylpyrimidine-5-carboxamide;molecular hydrogen?
The IUPAC name of ethene;N-heptyl-2-methylpyrimidine-5-carboxamide;molecular hydrogen (CID 144515256) is ethene;N-heptyl-2-methylpyrimidine-5-carboxamide;molecular hydrogen.
What is the SMILES notation for ethene;N-heptyl-2-methylpyrimidine-5-carboxamide;molecular hydrogen?
The canonical SMILES for ethene;N-heptyl-2-methylpyrimidine-5-carboxamide;molecular hydrogen is C=C.CCCCCCCNC(=O)c1cnc(C)nc1.[H][H].
What is the InChIKey of ethene;N-heptyl-2-methylpyrimidine-5-carboxamide;molecular hydrogen?
The InChIKey is BJYWPOTXRFNADL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O.C2H4.H2/c1-3-4-5-6-7-8-14-13(17)12-9-15-11(2)16-10-12;1-2;/h9-10H,3-8H2,1-2H3,(H,14,17);1-2H2;1H.
What are the key properties of ethene;N-heptyl-2-methylpyrimidine-5-carboxamide;molecular hydrogen?
ethene;N-heptyl-2-methylpyrimidine-5-carboxamide;molecular hydrogen has a molecular weight of 265.40 g/mol, XLogP of 3.53, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;N-heptyl-2-methylpyrimidine-5-carboxamide;molecular hydrogen is sourced from PubChem (CID 144515256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).