About 4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-1H-pyrazol-5-amine
4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-1H-pyrazol-5-amine (PubChem CID 144515390) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-1H-pyrazol-5-amine.
Molecular Properties
| Compound Name | 4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-1H-pyrazol-5-amine |
| PubChem CID | 144515390 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-1H-pyrazol-5-amine |
| SMILES | C=C/C=C(\C=C(C)C)c1cn[nH]c1N |
| InChI | InChI=1S/C11H15N3/c1-4-5-9(6-8(2)3)10-7-13-14-11(10)12/h4-7H,1H2,2-3H3,(H3,12,13,14)/b9-5+ |
| InChIKey | MCQZRNGIVNYHHV-WEVVVXLNSA-N |
| XLogP | 2.53 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-1H-pyrazol-5-amine?
The IUPAC name of 4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-1H-pyrazol-5-amine (CID 144515390) is 4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-1H-pyrazol-5-amine.
What is the SMILES notation for 4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-1H-pyrazol-5-amine?
The canonical SMILES for 4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-1H-pyrazol-5-amine is C=C/C=C(\C=C(C)C)c1cn[nH]c1N.
What is the InChIKey of 4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-1H-pyrazol-5-amine?
The InChIKey is MCQZRNGIVNYHHV-WEVVVXLNSA-N. The full InChI is InChI=1S/C11H15N3/c1-4-5-9(6-8(2)3)10-7-13-14-11(10)12/h4-7H,1H2,2-3H3,(H3,12,13,14)/b9-5+.
What are the key properties of 4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-1H-pyrazol-5-amine?
4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-1H-pyrazol-5-amine has a molecular weight of 189.26 g/mol, XLogP of 2.53, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]-1H-pyrazol-5-amine is sourced from PubChem (CID 144515390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).