About N-but-3-enyl-2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]acetamide;ethane
N-but-3-enyl-2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]acetamide;ethane (PubChem CID 144515549) has the molecular formula C18H33NO3
and a molecular weight of 311.47 g/mol. Its IUPAC name is N-but-3-enyl-2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]acetamide;ethane.
Molecular Properties
| Compound Name | N-but-3-enyl-2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]acetamide;ethane |
| PubChem CID | 144515549 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | N-but-3-enyl-2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]acetamide;ethane |
| SMILES | C=CCCNC(=O)COC/C(C)=C\CCC(C=C)OC.CC |
| InChI | InChI=1S/C16H27NO3.C2H6/c1-5-7-11-17-16(18)13-20-12-14(3)9-8-10-15(6-2)19-4;1-2/h5-6,9,15H,1-2,7-8,10-13H2,3-4H3,(H,17,18);1-2H3/b14-9-; |
| InChIKey | PPLVRSFCBYJQGQ-WQRRWHLMSA-N |
| XLogP | 3.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-but-3-enyl-2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]acetamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-3-enyl-2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]acetamide;ethane?
The IUPAC name of N-but-3-enyl-2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]acetamide;ethane (CID 144515549) is N-but-3-enyl-2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]acetamide;ethane.
What is the SMILES notation for N-but-3-enyl-2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]acetamide;ethane?
The canonical SMILES for N-but-3-enyl-2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]acetamide;ethane is C=CCCNC(=O)COC/C(C)=C\CCC(C=C)OC.CC.
What is the InChIKey of N-but-3-enyl-2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]acetamide;ethane?
The InChIKey is PPLVRSFCBYJQGQ-WQRRWHLMSA-N. The full InChI is InChI=1S/C16H27NO3.C2H6/c1-5-7-11-17-16(18)13-20-12-14(3)9-8-10-15(6-2)19-4;1-2/h5-6,9,15H,1-2,7-8,10-13H2,3-4H3,(H,17,18);1-2H3/b14-9-;.
What are the key properties of N-but-3-enyl-2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]acetamide;ethane?
N-but-3-enyl-2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]acetamide;ethane has a molecular weight of 311.47 g/mol, XLogP of 3.65, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-3-enyl-2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]acetamide;ethane is sourced from PubChem (CID 144515549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).