About ethane;7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;2-methylbutane
ethane;7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;2-methylbutane (PubChem CID 144515668) has the molecular formula C19H42N2O
and a molecular weight of 314.56 g/mol. Its IUPAC name is ethane;7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;2-methylbutane.
Molecular Properties
| Compound Name | ethane;7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;2-methylbutane |
| PubChem CID | 144515668 |
| Molecular Formula | C19H42N2O |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.33 |
| IUPAC Name | ethane;7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;2-methylbutane |
| SMILES | CC.CC.CC1CCC2(CC1)CN(C(N)=O)C2.CCC(C)C |
| InChI | InChI=1S/C10H18N2O.C5H12.2C2H6/c1-8-2-4-10(5-3-8)6-12(7-10)9(11)13;1-4-5(2)3;2*1-2/h8H,2-7H2,1H3,(H2,11,13);5H,4H2,1-3H3;2*1-2H3 |
| InChIKey | BJKDONGGXUUEQZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;2-methylbutane?
The IUPAC name of ethane;7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;2-methylbutane (CID 144515668) is ethane;7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;2-methylbutane.
What is the SMILES notation for ethane;7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;2-methylbutane?
The canonical SMILES for ethane;7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;2-methylbutane is CC.CC.CC1CCC2(CC1)CN(C(N)=O)C2.CCC(C)C.
What is the InChIKey of ethane;7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;2-methylbutane?
The InChIKey is BJKDONGGXUUEQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O.C5H12.2C2H6/c1-8-2-4-10(5-3-8)6-12(7-10)9(11)13;1-4-5(2)3;2*1-2/h8H,2-7H2,1H3,(H2,11,13);5H,4H2,1-3H3;2*1-2H3.
What are the key properties of ethane;7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;2-methylbutane?
ethane;7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;2-methylbutane has a molecular weight of 314.56 g/mol, XLogP of 5.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;2-methylbutane is sourced from PubChem (CID 144515668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).