About ethane;methanamine;N,N,7-trimethyl-2-azaspiro[3.5]nonane-2-carboxamide
ethane;methanamine;N,N,7-trimethyl-2-azaspiro[3.5]nonane-2-carboxamide (PubChem CID 144515772) has the molecular formula C19H45N3O
and a molecular weight of 331.59 g/mol. Its IUPAC name is ethane;methanamine;N,N,7-trimethyl-2-azaspiro[3.5]nonane-2-carboxamide.
Molecular Properties
| Compound Name | ethane;methanamine;N,N,7-trimethyl-2-azaspiro[3.5]nonane-2-carboxamide |
| PubChem CID | 144515772 |
| Molecular Formula | C19H45N3O |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 331.36 |
| IUPAC Name | ethane;methanamine;N,N,7-trimethyl-2-azaspiro[3.5]nonane-2-carboxamide |
| SMILES | CC.CC.CC.CC1CCC2(CC1)CN(C(=O)N(C)C)C2.CN |
| InChI | InChI=1S/C12H22N2O.3C2H6.CH5N/c1-10-4-6-12(7-5-10)8-14(9-12)11(15)13(2)3;4*1-2/h10H,4-9H2,1-3H3;3*1-2H3;2H2,1H3 |
| InChIKey | LEFZLNJYYLZYAL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methanamine;N,N,7-trimethyl-2-azaspiro[3.5]nonane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanamine;N,N,7-trimethyl-2-azaspiro[3.5]nonane-2-carboxamide?
The IUPAC name of ethane;methanamine;N,N,7-trimethyl-2-azaspiro[3.5]nonane-2-carboxamide (CID 144515772) is ethane;methanamine;N,N,7-trimethyl-2-azaspiro[3.5]nonane-2-carboxamide.
What is the SMILES notation for ethane;methanamine;N,N,7-trimethyl-2-azaspiro[3.5]nonane-2-carboxamide?
The canonical SMILES for ethane;methanamine;N,N,7-trimethyl-2-azaspiro[3.5]nonane-2-carboxamide is CC.CC.CC.CC1CCC2(CC1)CN(C(=O)N(C)C)C2.CN.
What is the InChIKey of ethane;methanamine;N,N,7-trimethyl-2-azaspiro[3.5]nonane-2-carboxamide?
The InChIKey is LEFZLNJYYLZYAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O.3C2H6.CH5N/c1-10-4-6-12(7-5-10)8-14(9-12)11(15)13(2)3;4*1-2/h10H,4-9H2,1-3H3;3*1-2H3;2H2,1H3.
What are the key properties of ethane;methanamine;N,N,7-trimethyl-2-azaspiro[3.5]nonane-2-carboxamide?
ethane;methanamine;N,N,7-trimethyl-2-azaspiro[3.5]nonane-2-carboxamide has a molecular weight of 331.59 g/mol, XLogP of 4.83, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanamine;N,N,7-trimethyl-2-azaspiro[3.5]nonane-2-carboxamide is sourced from PubChem (CID 144515772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).