C14H22N2O — CID 144516230
N'-(4-ethynyl-3-methoxycyclohexa-1,3-dien-1-yl)-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 144516230) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is N'-(4-ethynyl-3-methoxycyclohexa-1,3-dien-1-yl)-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-(4-ethynyl-3-methoxycyclohexa-1,3-dien-1-yl)-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 144516230 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N'-(4-ethynyl-3-methoxycyclohexa-1,3-dien-1-yl)-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | C#CC1=C(OC)C=C(N(C)CCN(C)C)CC1 |
| InChI | InChI=1S/C14H22N2O/c1-6-12-7-8-13(11-14(12)17-5)16(4)10-9-15(2)3/h1,11H,7-10H2,2-5H3 |
| InChIKey | ICCHMKCMGJAJDV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|