C26H32N2O5 — CID 144516320
ethane;5-[[7-(3,4,5-trimethoxyphenyl)quinolin-5-yl]oxymethyl]piperidin-2-one (PubChem CID 144516320) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is ethane;5-[[7-(3,4,5-trimethoxyphenyl)quinolin-5-yl]oxymethyl]piperidin-2-one.
| Compound Name | ethane;5-[[7-(3,4,5-trimethoxyphenyl)quinolin-5-yl]oxymethyl]piperidin-2-one |
|---|---|
| PubChem CID | 144516320 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | ethane;5-[[7-(3,4,5-trimethoxyphenyl)quinolin-5-yl]oxymethyl]piperidin-2-one |
| SMILES | CC.COc1cc(-c2cc(OCC3CCC(=O)NC3)c3cccnc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H26N2O5.C2H6/c1-28-21-11-17(12-22(29-2)24(21)30-3)16-9-19-18(5-4-8-25-19)20(10-16)31-14-15-6-7-23(27)26-13-15;1-2/h4-5,8-12,15H,6-7,13-14H2,1-3H3,(H,26,27);1-2H3 |
| InChIKey | XXQWOXWNAMYCQA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |